C21H33NO2 — CID 67764423
(1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-9a,11a-dimethyl-1-prop-2-enyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one (PubChem CID 67764423) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-9a,11a-dimethyl-1-prop-2-enyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-9a,11a-dimethyl-1-prop-2-enyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 67764423 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-9a,11a-dimethyl-1-prop-2-enyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one |
| SMILES | C=CC[C@]1(O)CC[C@H]2[C@@H]3CC[C@H]4NC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H33NO2/c1-4-10-21(24)13-8-16-14-5-6-17-19(2,11-9-18(23)22-17)15(14)7-12-20(16,21)3/h4,14-17,24H,1,5-13H2,2-3H3,(H,22,23)/t14-,15+,16+,17-,19-,20+,21+/m1/s1 |
| InChIKey | UNUNLTGRHIFMBU-ROVFHEEESA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|