C12H16O7 — CID 67764538
1-(furan-2-yl)-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone (PubChem CID 67764538) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone.
| Compound Name | 1-(furan-2-yl)-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 67764538 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-(furan-2-yl)-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
| SMILES | O=C(C[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccco1 |
| InChI | InChI=1S/C12H16O7/c13-5-9-11(16)12(17)10(15)8(19-9)4-6(14)7-2-1-3-18-7/h1-3,8-13,15-17H,4-5H2/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | VAWGOLGWNLIJFE-RNWYCLNJSA-N |
| XLogP | -1.31 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |