C10H8BrN3O2 — CID 67767763
N-(5-bromo-2-pyridinyl)-2-cyano-3-hydroxybut-2-enamide (PubChem CID 67767763) has the molecular formula C10H8BrN3O2 and a molecular weight of 282.10 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-cyano-3-hydroxybut-2-enamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-cyano-3-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 67767763 |
| Molecular Formula | C10H8BrN3O2 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-cyano-3-hydroxybut-2-enamide |
| SMILES | CC(O)=C(C#N)C(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C10H8BrN3O2/c1-6(15)8(4-12)10(16)14-9-3-2-7(11)5-13-9/h2-3,5,15H,1H3,(H,13,14,16) |
| InChIKey | NUPWCMUDZBAYEO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|