C16H21N5O5S — CID 67768716
[2-[[5-[2-[(2-amino-2-methoxyethyl)iminomethylamino]-1,3-thiazol-4-yl]furan-2-yl]methylamino]-2-oxoethyl] acetate (PubChem CID 67768716) has the molecular formula C16H21N5O5S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-[[5-[2-[(2-amino-2-methoxyethyl)iminomethylamino]-1,3-thiazol-4-yl]furan-2-yl]methylamino]-2-oxoethyl] acetate.
| Compound Name | [2-[[5-[2-[(2-amino-2-methoxyethyl)iminomethylamino]-1,3-thiazol-4-yl]furan-2-yl]methylamino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 67768716 |
| Molecular Formula | C16H21N5O5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-[[5-[2-[(2-amino-2-methoxyethyl)iminomethylamino]-1,3-thiazol-4-yl]furan-2-yl]methylamino]-2-oxoethyl] acetate |
| SMILES | COC(N)C/N=C/Nc1nc(-c2ccc(CNC(=O)COC(C)=O)o2)cs1 |
| InChI | InChI=1S/C16H21N5O5S/c1-10(22)25-7-15(23)19-5-11-3-4-13(26-11)12-8-27-16(21-12)20-9-18-6-14(17)24-2/h3-4,8-9,14H,5-7,17H2,1-2H3,(H,19,23)(H,18,20,21) |
| InChIKey | FLQKTNIMXJGBKG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|