C14H12F3N3O5 — CID 67769993
(3S,6R,10R)-8-[(Z)-2-cyanoethenyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 67769993) has the molecular formula C14H12F3N3O5 and a molecular weight of 359.26 g/mol. Its IUPAC name is (3S,6R,10R)-8-[(Z)-2-cyanoethenyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,6R,10R)-8-[(Z)-2-cyanoethenyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67769993 |
| Molecular Formula | C14H12F3N3O5 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (3S,6R,10R)-8-[(Z)-2-cyanoethenyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | N#C/C=C\C1=C(C(=O)O)N2C(=O)[C@H]3NC[C@@H](C1)[C@H]32.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H11N3O3.C2HF3O2/c13-3-1-2-6-4-7-5-14-8-9(7)15(11(8)16)10(6)12(17)18;3-2(4,5)1(6)7/h1-2,7-9,14H,4-5H2,(H,17,18);(H,6,7)/b2-1-;/t7-,8+,9-;/m1./s1 |
| InChIKey | KULRMYJQTDVGRM-KCIPYOQXSA-N |
| XLogP | 0.24 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|