C13H13F3N2O5 — CID 67769323
(1S,10R)-5-ethenyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 67769323) has the molecular formula C13H13F3N2O5 and a molecular weight of 334.25 g/mol. Its IUPAC name is (1S,10R)-5-ethenyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,10R)-5-ethenyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67769323 |
| Molecular Formula | C13H13F3N2O5 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (1S,10R)-5-ethenyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)[C@H]3NCCC1[C@H]32.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H12N2O3.C2HF3O2/c1-2-5-6-3-4-12-7-8(6)13(10(7)14)9(5)11(15)16;3-2(4,5)1(6)7/h2,6-8,12H,1,3-4H2,(H,15,16);(H,6,7)/t6?,7-,8+;/m0./s1 |
| InChIKey | KKTKFLJDZVKJPV-UJXVHCJJSA-N |
| XLogP | 0.35 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |