C40H42N2O8 — CID 67770831
3,3-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 67770831) has the molecular formula C40H42N2O8 and a molecular weight of 678.78 g/mol. Its IUPAC name is 3,3-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | 3,3-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67770831 |
| Molecular Formula | C40H42N2O8 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | 3,3-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CCCN(Cc1ccc(Oc2ccccc2)cc1)C(=O)C1(C(=O)N(CCC)Cc2ccc(Oc3ccccc3)cc2)CC(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C40H42N2O8/c1-3-23-41(26-28-15-19-32(20-16-28)49-30-11-7-5-8-12-30)38(47)40(25-34(36(43)44)35(40)37(45)46)39(48)42(24-4-2)27-29-17-21-33(22-18-29)50-31-13-9-6-10-14-31/h5-22,34-35H,3-4,23-27H2,1-2H3,(H,43,44)(H,45,46) |
| InChIKey | ULUFVOMBPRURAH-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|