C20H16F2N2O2 — CID 67772794
methyl 3-[[6-(2,4-difluorophenyl)-2-pyridinyl]amino]-4-methylbenzoate (PubChem CID 67772794) has the molecular formula C20H16F2N2O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is methyl 3-[[6-(2,4-difluorophenyl)-2-pyridinyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[6-(2,4-difluorophenyl)-2-pyridinyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 67772794 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 3-[[6-(2,4-difluorophenyl)-2-pyridinyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(Nc2cccc(-c3ccc(F)cc3F)n2)c1 |
| InChI | InChI=1S/C20H16F2N2O2/c1-12-6-7-13(20(25)26-2)10-18(12)24-19-5-3-4-17(23-19)15-9-8-14(21)11-16(15)22/h3-11H,1-2H3,(H,23,24) |
| InChIKey | PRIWWVAPILBDBO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |