C21H31ClN2O — CID 67772988
4-chloro-N-cyclopentyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide (PubChem CID 67772988) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is 4-chloro-N-cyclopentyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-cyclopentyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 67772988 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-chloro-N-cyclopentyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](CN1CCCC1)N(C(=O)c1ccc(Cl)cc1)C1CCCC1 |
| InChI | InChI=1S/C21H31ClN2O/c1-16(2)20(15-23-13-5-6-14-23)24(19-7-3-4-8-19)21(25)17-9-11-18(22)12-10-17/h9-12,16,19-20H,3-8,13-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | IZCLSWWADOFPSN-HXUWFJFHSA-N |
| XLogP | 4.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |