C26H38BrNO3Si — CID 67777123
2-[2-bromo-4-(cyclopropylmethoxy)phenyl]-1-[5-tri(propan-2-yl)silyloxy-2-pyridinyl]ethanol (PubChem CID 67777123) has the molecular formula C26H38BrNO3Si and a molecular weight of 520.58 g/mol. Its IUPAC name is 2-[2-bromo-4-(cyclopropylmethoxy)phenyl]-1-[5-tri(propan-2-yl)silyloxy-2-pyridinyl]ethanol.
| Compound Name | 2-[2-bromo-4-(cyclopropylmethoxy)phenyl]-1-[5-tri(propan-2-yl)silyloxy-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 67777123 |
| Molecular Formula | C26H38BrNO3Si |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 2-[2-bromo-4-(cyclopropylmethoxy)phenyl]-1-[5-tri(propan-2-yl)silyloxy-2-pyridinyl]ethanol |
| SMILES | CC(C)[Si](Oc1ccc(C(O)Cc2ccc(OCC3CC3)cc2Br)nc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H38BrNO3Si/c1-17(2)32(18(3)4,19(5)6)31-23-11-12-25(28-15-23)26(29)13-21-9-10-22(14-24(21)27)30-16-20-7-8-20/h9-12,14-15,17-20,26,29H,7-8,13,16H2,1-6H3 |
| InChIKey | UZYFQGAOVJSCJG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|