C14H18O6 — CID 67779992
2-hydroxy-2-[4-[1-(oxolan-2-yloxy)ethoxy]phenyl]acetic acid (PubChem CID 67779992) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-hydroxy-2-[4-[1-(oxolan-2-yloxy)ethoxy]phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[4-[1-(oxolan-2-yloxy)ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 67779992 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-hydroxy-2-[4-[1-(oxolan-2-yloxy)ethoxy]phenyl]acetic acid |
| SMILES | CC(Oc1ccc(C(O)C(=O)O)cc1)OC1CCCO1 |
| InChI | InChI=1S/C14H18O6/c1-9(20-12-3-2-8-18-12)19-11-6-4-10(5-7-11)13(15)14(16)17/h4-7,9,12-13,15H,2-3,8H2,1H3,(H,16,17) |
| InChIKey | JFCNBPRSRDLPEL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|