C15H18O7 — CID 67781101
5-ethoxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-5-oxopent-3-enoic acid (PubChem CID 67781101) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is 5-ethoxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-5-oxopent-3-enoic acid.
| Compound Name | 5-ethoxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-5-oxopent-3-enoic acid |
|---|---|
| PubChem CID | 67781101 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-ethoxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-5-oxopent-3-enoic acid |
| SMILES | CCOC(=O)C=C(CC(=O)O)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C15H18O7/c1-4-22-14(18)8-10(7-13(16)17)9-5-11(20-2)15(19)12(6-9)21-3/h5-6,8,19H,4,7H2,1-3H3,(H,16,17) |
| InChIKey | FUFVWYWUBGJFMT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|