C22H29N3O6S — CID 67783189
3-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]-1-(2-methylpropyl)-2H-pyridine-6-carboxylic acid (PubChem CID 67783189) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is 3-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]-1-(2-methylpropyl)-2H-pyridine-6-carboxylic acid.
| Compound Name | 3-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]-1-(2-methylpropyl)-2H-pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 67783189 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 3-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]-1-(2-methylpropyl)-2H-pyridine-6-carboxylic acid |
| SMILES | CCCCNC(=O)c1ccc(S(=O)(=O)NC(=O)C2=CC=C(C(=O)O)N(CC(C)C)C2)cc1 |
| InChI | InChI=1S/C22H29N3O6S/c1-4-5-12-23-20(26)16-6-9-18(10-7-16)32(30,31)24-21(27)17-8-11-19(22(28)29)25(14-17)13-15(2)3/h6-11,15H,4-5,12-14H2,1-3H3,(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | ZGFZFIBGLXRUBB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|