About ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate
ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate (PubChem CID 67783464) has the molecular formula C11H13FO2
and a molecular weight of 196.22 g/mol. Its IUPAC name is ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate |
| PubChem CID | 67783464 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate |
| SMILES | CCOC(=O)CC1C=CC(=CF)C=C1 |
| InChI | InChI=1S/C11H13FO2/c1-2-14-11(13)7-9-3-5-10(8-12)6-4-9/h3-6,8-9H,2,7H2,1H3/b10-8- |
| InChIKey | JAIQGIPJSUZNED-NTMALXAHSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate?
The IUPAC name of ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate (CID 67783464) is ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate.
What is the SMILES notation for ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate?
The canonical SMILES for ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate is CCOC(=O)CC1C=CC(=CF)C=C1.
What is the InChIKey of ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate?
The InChIKey is JAIQGIPJSUZNED-NTMALXAHSA-N. The full InChI is InChI=1S/C11H13FO2/c1-2-14-11(13)7-9-3-5-10(8-12)6-4-9/h3-6,8-9H,2,7H2,1H3/b10-8-.
What are the key properties of ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate?
ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate has a molecular weight of 196.22 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-(fluoromethylidene)cyclohexa-2,5-dien-1-yl]acetate is sourced from PubChem (CID 67783464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).