C24H36F2O — CID 67785014
1-(difluoromethoxy)-4-[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]benzene (PubChem CID 67785014) has the molecular formula C24H36F2O and a molecular weight of 378.55 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1-(difluoromethoxy)-4-[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 67785014 |
| Molecular Formula | C24H36F2O |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-(difluoromethoxy)-4-[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]benzene |
| SMILES | CCCC(C)C1(C2CCC(c3ccc(OC(F)F)cc3)CC2)CCCCC1 |
| InChI | InChI=1S/C24H36F2O/c1-3-7-18(2)24(16-5-4-6-17-24)21-12-8-19(9-13-21)20-10-14-22(15-11-20)27-23(25)26/h10-11,14-15,18-19,21,23H,3-9,12-13,16-17H2,1-2H3 |
| InChIKey | VKBLCGFNVUKDJO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |