C17H22N2O6S — CID 67785403
prop-2-enyl (5R,6R)-3,3-dimethyl-7-oxo-6-[(3-oxo-3-prop-2-enoxypropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 67785403) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is prop-2-enyl (5R,6R)-3,3-dimethyl-7-oxo-6-[(3-oxo-3-prop-2-enoxypropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | prop-2-enyl (5R,6R)-3,3-dimethyl-7-oxo-6-[(3-oxo-3-prop-2-enoxypropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 67785403 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | prop-2-enyl (5R,6R)-3,3-dimethyl-7-oxo-6-[(3-oxo-3-prop-2-enoxypropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)CC(=O)N[C@@H]1C(=O)N2C(C(=O)OCC=C)C(C)(C)S[C@H]12 |
| InChI | InChI=1S/C17H22N2O6S/c1-5-7-24-11(21)9-10(20)18-12-14(22)19-13(16(23)25-8-6-2)17(3,4)26-15(12)19/h5-6,12-13,15H,1-2,7-9H2,3-4H3,(H,18,20)/t12-,13?,15-/m1/s1 |
| InChIKey | QPRFCZKEOADRCC-ILWWEHDPSA-N |
| XLogP | 0.38 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|