C16H22N2O8S — CID 54529713
prop-2-enyl (5S,6R)-6-[(3-ethoxy-3-oxopropanoyl)amino]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54529713) has the molecular formula C16H22N2O8S and a molecular weight of 402.43 g/mol. Its IUPAC name is prop-2-enyl (5S,6R)-6-[(3-ethoxy-3-oxopropanoyl)amino]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | prop-2-enyl (5S,6R)-6-[(3-ethoxy-3-oxopropanoyl)amino]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54529713 |
| Molecular Formula | C16H22N2O8S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | prop-2-enyl (5S,6R)-6-[(3-ethoxy-3-oxopropanoyl)amino]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)C1N2C(=O)[C@@H](NC(=O)CC(=O)OCC)[C@@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C16H22N2O8S/c1-5-7-26-15(22)12-16(3,4)27(23,24)14-11(13(21)18(12)14)17-9(19)8-10(20)25-6-2/h5,11-12,14H,1,6-8H2,2-4H3,(H,17,19)/t11-,12?,14+/m1/s1 |
| InChIKey | YVQGARSJPVANRZ-SOGVLRHJSA-N |
| XLogP | -1.10 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|