C10H14N2O7S2 — CID 10065713
(2S,5R,6R)-6-(ethenylsulfonylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 10065713) has the molecular formula C10H14N2O7S2 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2S,5R,6R)-6-(ethenylsulfonylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-(ethenylsulfonylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 10065713 |
| Molecular Formula | C10H14N2O7S2 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | (2S,5R,6R)-6-(ethenylsulfonylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C=CS(=O)(=O)N[C@@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C10H14N2O7S2/c1-4-20(16,17)11-5-7(13)12-6(9(14)15)10(2,3)21(18,19)8(5)12/h4-6,8,11H,1H2,2-3H3,(H,14,15)/t5-,6+,8-/m1/s1 |
| InChIKey | YUKSIPCDGIXTNE-GKROBHDKSA-N |
| XLogP | -1.75 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |