C14H20N2O7S — CID 52918093
(2S,5R,6R)-6-(1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 52918093) has the molecular formula C14H20N2O7S and a molecular weight of 360.39 g/mol. Its IUPAC name is (2S,5R,6R)-6-(1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-(1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 52918093 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2S,5R,6R)-6-(1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)[C@@H](C(O)C(=O)N3CCCC3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C14H20N2O7S/c1-14(2)9(13(20)21)16-10(18)7(12(16)24(14,22)23)8(17)11(19)15-5-3-4-6-15/h7-9,12,17H,3-6H2,1-2H3,(H,20,21)/t7-,8?,9+,12-/m1/s1 |
| InChIKey | PJMPNJOAQFKEEF-UXSTWLAOSA-N |
| XLogP | -1.59 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |