C18H22N2O7S — CID 67934115
prop-2-enyl (2S,5R,6R)-6-[(1-acetylpyrrol-2-yl)-hydroxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 67934115) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is prop-2-enyl (2S,5R,6R)-6-[(1-acetylpyrrol-2-yl)-hydroxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,5R,6R)-6-[(1-acetylpyrrol-2-yl)-hydroxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 67934115 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | prop-2-enyl (2S,5R,6R)-6-[(1-acetylpyrrol-2-yl)-hydroxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1N2C(=O)[C@@H](C(O)c3cccn3C(C)=O)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C18H22N2O7S/c1-5-9-27-17(24)14-18(3,4)28(25,26)16-12(15(23)20(14)16)13(22)11-7-6-8-19(11)10(2)21/h5-8,12-14,16,22H,1,9H2,2-4H3/t12-,13?,14+,16-/m1/s1 |
| InChIKey | WFFWAOLOQXQNNX-IOJLXPLISA-N |
| XLogP | 0.27 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|