C9H12BrNO5S — CID 54319009
(2S,5R,6R)-6-(bromomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54319009) has the molecular formula C9H12BrNO5S and a molecular weight of 326.17 g/mol. Its IUPAC name is (2S,5R,6R)-6-(bromomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-(bromomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54319009 |
| Molecular Formula | C9H12BrNO5S |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | (2S,5R,6R)-6-(bromomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)[C@@H](CBr)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C9H12BrNO5S/c1-9(2)5(8(13)14)11-6(12)4(3-10)7(11)17(9,15)16/h4-5,7H,3H2,1-2H3,(H,13,14)/t4-,5+,7-/m1/s1 |
| InChIKey | SQGYJNZYDHNNLE-JCGDXUMPSA-N |
| XLogP | -0.17 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|