C11H16ClNO6S — CID 70482291
1-chloroethyl (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70482291) has the molecular formula C11H16ClNO6S and a molecular weight of 325.77 g/mol. Its IUPAC name is 1-chloroethyl (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1-chloroethyl (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70482291 |
| Molecular Formula | C11H16ClNO6S |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1-chloroethyl (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(Cl)OC(=O)[C@@H]1N2C(=O)[C@@H](CO)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C11H16ClNO6S/c1-5(12)19-10(16)7-11(2,3)20(17,18)9-6(4-14)8(15)13(7)9/h5-7,9,14H,4H2,1-3H3/t5?,6-,7+,9-/m1/s1 |
| InChIKey | JUNNKUTUVHHORW-YVPPNDTHSA-N |
| XLogP | -0.53 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|