C10H11Cl4NO5S — CID 70587464
2,2,2-trichloroethyl (2S,5R,6S)-6-chloro-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70587464) has the molecular formula C10H11Cl4NO5S and a molecular weight of 399.08 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S,5R,6S)-6-chloro-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (2S,5R,6S)-6-chloro-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70587464 |
| Molecular Formula | C10H11Cl4NO5S |
| Molecular Weight | 399.08 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | 2,2,2-trichloroethyl (2S,5R,6S)-6-chloro-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCC(Cl)(Cl)Cl)N2C(=O)[C@H](Cl)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C10H11Cl4NO5S/c1-9(2)5(8(17)20-3-10(12,13)14)15-6(16)4(11)7(15)21(9,18)19/h4-5,7H,3H2,1-2H3/t4-,5-,7+/m0/s1 |
| InChIKey | IEHQQKNRUULPGV-KZLJYQGOSA-N |
| XLogP | 1.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.08 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|