C10H11ClN2O5S2 — CID 54500475
chloromethyl (2S,5R,6R)-6-isothiocyanato-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54500475) has the molecular formula C10H11ClN2O5S2 and a molecular weight of 338.79 g/mol. Its IUPAC name is chloromethyl (2S,5R,6R)-6-isothiocyanato-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | chloromethyl (2S,5R,6R)-6-isothiocyanato-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54500475 |
| Molecular Formula | C10H11ClN2O5S2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | chloromethyl (2S,5R,6R)-6-isothiocyanato-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCCl)N2C(=O)[C@@H](N=C=S)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C10H11ClN2O5S2/c1-10(2)6(9(15)18-3-11)13-7(14)5(12-4-19)8(13)20(10,16)17/h5-6,8H,3H2,1-2H3/t5-,6+,8-/m1/s1 |
| InChIKey | YCBKDKULKIQKGK-GKROBHDKSA-N |
| XLogP | -0.06 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|