C11H12Cl3N3O3S2 — CID 22789612
2,2,2-trichloroethyl (5S)-6-amino-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22789612) has the molecular formula C11H12Cl3N3O3S2 and a molecular weight of 404.73 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (5S)-6-amino-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (5S)-6-amino-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22789612 |
| Molecular Formula | C11H12Cl3N3O3S2 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 2,2,2-trichloroethyl (5S)-6-amino-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(CSC#N)S[C@H]2C(N)C(=O)N2C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3N3O3S2/c1-10(3-21-4-15)6(9(19)20-2-11(12,13)14)17-7(18)5(16)8(17)22-10/h5-6,8H,2-3,16H2,1H3/t5?,6?,8-,10?/m0/s1 |
| InChIKey | DNBHERPCMJFUTI-DTRDVEORSA-N |
| XLogP | 1.48 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|