C27H33NO3 — CID 67787231
4-[3-[5-[4-(2-methylpropyl)phenyl]pentanoyl]-1H-indol-2-yl]butanoic acid (PubChem CID 67787231) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[3-[5-[4-(2-methylpropyl)phenyl]pentanoyl]-1H-indol-2-yl]butanoic acid.
| Compound Name | 4-[3-[5-[4-(2-methylpropyl)phenyl]pentanoyl]-1H-indol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 67787231 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 4-[3-[5-[4-(2-methylpropyl)phenyl]pentanoyl]-1H-indol-2-yl]butanoic acid |
| SMILES | CC(C)Cc1ccc(CCCCC(=O)c2c(CCCC(=O)O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H33NO3/c1-19(2)18-21-16-14-20(15-17-21)8-3-6-12-25(29)27-22-9-4-5-10-23(22)28-24(27)11-7-13-26(30)31/h4-5,9-10,14-17,19,28H,3,6-8,11-13,18H2,1-2H3,(H,30,31) |
| InChIKey | AZUJFCBQLPXHSH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|