C33H35NO4 — CID 67839904
4-[3-[4-[4-[4-(cyclopropylmethyl)phenyl]butoxy]benzoyl]-1H-indol-2-yl]butanoic acid (PubChem CID 67839904) has the molecular formula C33H35NO4 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-[3-[4-[4-[4-(cyclopropylmethyl)phenyl]butoxy]benzoyl]-1H-indol-2-yl]butanoic acid.
| Compound Name | 4-[3-[4-[4-[4-(cyclopropylmethyl)phenyl]butoxy]benzoyl]-1H-indol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 67839904 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 4-[3-[4-[4-[4-(cyclopropylmethyl)phenyl]butoxy]benzoyl]-1H-indol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1[nH]c2ccccc2c1C(=O)c1ccc(OCCCCc2ccc(CC3CC3)cc2)cc1 |
| InChI | InChI=1S/C33H35NO4/c35-31(36)10-5-9-30-32(28-7-1-2-8-29(28)34-30)33(37)26-17-19-27(20-18-26)38-21-4-3-6-23-11-13-24(14-12-23)22-25-15-16-25/h1-2,7-8,11-14,17-20,25,34H,3-6,9-10,15-16,21-22H2,(H,35,36) |
| InChIKey | IUBZYAZMWDYDDP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|