C27H40O9 — CID 67790159
[(4R,5R)-5-methoxycarbonyloxy-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3-dioxolan-4-yl] methyl carbonate (PubChem CID 67790159) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(4R,5R)-5-methoxycarbonyloxy-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3-dioxolan-4-yl] methyl carbonate.
| Compound Name | [(4R,5R)-5-methoxycarbonyloxy-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3-dioxolan-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 67790159 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(4R,5R)-5-methoxycarbonyloxy-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3-dioxolan-4-yl] methyl carbonate |
| SMILES | CCCCCC1CCC(CCCOc2ccc(C3O[C@H](OC(=O)OC)[C@@H](OC(=O)OC)O3)cc2)CC1 |
| InChI | InChI=1S/C27H40O9/c1-4-5-6-8-19-10-12-20(13-11-19)9-7-18-32-22-16-14-21(15-17-22)23-33-24(35-26(28)30-2)25(34-23)36-27(29)31-3/h14-17,19-20,23-25H,4-13,18H2,1-3H3/t19?,20?,24-,25-/m1/s1 |
| InChIKey | MKARVMZMQJKHMW-LTBUFCQKSA-N |
| XLogP | 6.50 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|