C23H30O7-2 — CID 19042578
2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 19042578) has the molecular formula C23H30O7-2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | 2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 19042578 |
| Molecular Formula | C23H30O7-2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCCC1CCC(CCCOc2ccc(C3OC(C(=O)[O-])C(C(=O)[O-])O3)cc2)CC1 |
| InChI | InChI=1S/C23H32O7/c1-2-4-15-6-8-16(9-7-15)5-3-14-28-18-12-10-17(11-13-18)23-29-19(21(24)25)20(30-23)22(26)27/h10-13,15-16,19-20,23H,2-9,14H2,1H3,(H,24,25)(H,26,27)/p-2 |
| InChIKey | GWUPUMAEAOAEEG-UHFFFAOYSA-L |
| XLogP | 1.73 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|