C39H46N2O12 — CID 67791699
tert-butyl (3R,4R)-3-[3-butoxy-4-(2-butoxycarbonyl-6-hydroxybenzoyl)-5-hydroxybenzoyl]oxy-4-[(4-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 67791699) has the molecular formula C39H46N2O12 and a molecular weight of 734.80 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[3-butoxy-4-(2-butoxycarbonyl-6-hydroxybenzoyl)-5-hydroxybenzoyl]oxy-4-[(4-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[3-butoxy-4-(2-butoxycarbonyl-6-hydroxybenzoyl)-5-hydroxybenzoyl]oxy-4-[(4-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67791699 |
| Molecular Formula | C39H46N2O12 |
| Molecular Weight | 734.80 g/mol |
| Exact Mass | 734.31 |
| IUPAC Name | tert-butyl (3R,4R)-3-[3-butoxy-4-(2-butoxycarbonyl-6-hydroxybenzoyl)-5-hydroxybenzoyl]oxy-4-[(4-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)c1cccc(O)c1C(=O)c1c(O)cc(C(=O)O[C@@H]2CN(C(=O)OC(C)(C)C)C[C@H]2NC(=O)c2ccc(O)cc2)cc1OCCCC |
| InChI | InChI=1S/C39H46N2O12/c1-6-8-17-50-30-20-24(19-29(44)33(30)34(45)32-26(11-10-12-28(32)43)37(48)51-18-9-7-2)36(47)52-31-22-41(38(49)53-39(3,4)5)21-27(31)40-35(46)23-13-15-25(42)16-14-23/h10-16,19-20,27,31,42-44H,6-9,17-18,21-22H2,1-5H3,(H,40,46)/t27-,31-/m1/s1 |
| InChIKey | KVLCZHHSGMUVTD-DLFZDVPBSA-N |
| XLogP | 5.74 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|