C14H22N4 — CID 67792416
N'-[2-(2-aminoethyl)-1H-isoquinolin-5-yl]-N-methylethane-1,2-diamine (PubChem CID 67792416) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N'-[2-(2-aminoethyl)-1H-isoquinolin-5-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-(2-aminoethyl)-1H-isoquinolin-5-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 67792416 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N'-[2-(2-aminoethyl)-1H-isoquinolin-5-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1cccc2c1C=CN(CCN)C2 |
| InChI | InChI=1S/C14H22N4/c1-16-7-8-17-14-4-2-3-12-11-18(10-6-15)9-5-13(12)14/h2-5,9,16-17H,6-8,10-11,15H2,1H3 |
| InChIKey | JQHZRLDNGSOYAV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|