C11H11ClO4 — CID 67793213
(5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl) hydrogen carbonate (PubChem CID 67793213) has the molecular formula C11H11ClO4 and a molecular weight of 242.66 g/mol. Its IUPAC name is (5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl) hydrogen carbonate.
| Compound Name | (5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 67793213 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl) hydrogen carbonate |
| SMILES | CC1(C)Cc2cc(Cl)cc(OC(=O)O)c2O1 |
| InChI | InChI=1S/C11H11ClO4/c1-11(2)5-6-3-7(12)4-8(9(6)16-11)15-10(13)14/h3-4H,5H2,1-2H3,(H,13,14) |
| InChIKey | HRHYZOXEVPMXQF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|