C16H15ClO — CID 145039185
5-chloro-2,2-dimethyl-7-phenyl-3H-1-benzofuran (PubChem CID 145039185) has the molecular formula C16H15ClO and a molecular weight of 258.75 g/mol. Its IUPAC name is 5-chloro-2,2-dimethyl-7-phenyl-3H-1-benzofuran.
| Compound Name | 5-chloro-2,2-dimethyl-7-phenyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 145039185 |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 5-chloro-2,2-dimethyl-7-phenyl-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cc(Cl)cc(-c3ccccc3)c2O1 |
| InChI | InChI=1S/C16H15ClO/c1-16(2)10-12-8-13(17)9-14(15(12)18-16)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | FJNVVWLIGRIXPG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |