C24H24O5S — CID 67799416
4-[[2-(2-ethylphenyl)-6-methylsulfonylphenoxy]methyl]-2-methylbenzoic acid (PubChem CID 67799416) has the molecular formula C24H24O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 4-[[2-(2-ethylphenyl)-6-methylsulfonylphenoxy]methyl]-2-methylbenzoic acid.
| Compound Name | 4-[[2-(2-ethylphenyl)-6-methylsulfonylphenoxy]methyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 67799416 |
| Molecular Formula | C24H24O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-[[2-(2-ethylphenyl)-6-methylsulfonylphenoxy]methyl]-2-methylbenzoic acid |
| SMILES | CCc1ccccc1-c1cccc(S(C)(=O)=O)c1OCc1ccc(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C24H24O5S/c1-4-18-8-5-6-9-20(18)21-10-7-11-22(30(3,27)28)23(21)29-15-17-12-13-19(24(25)26)16(2)14-17/h5-14H,4,15H2,1-3H3,(H,25,26) |
| InChIKey | AJTOKEJJGZIDKB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |