C16H30N4O4 — CID 67801304
2-[2-[[4-(piperidin-4-ylmethoxy)piperidine-1-carbonyl]amino]ethylamino]acetic acid (PubChem CID 67801304) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[2-[[4-(piperidin-4-ylmethoxy)piperidine-1-carbonyl]amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[[4-(piperidin-4-ylmethoxy)piperidine-1-carbonyl]amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 67801304 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-[2-[[4-(piperidin-4-ylmethoxy)piperidine-1-carbonyl]amino]ethylamino]acetic acid |
| SMILES | O=C(O)CNCCNC(=O)N1CCC(OCC2CCNCC2)CC1 |
| InChI | InChI=1S/C16H30N4O4/c21-15(22)11-18-7-8-19-16(23)20-9-3-14(4-10-20)24-12-13-1-5-17-6-2-13/h13-14,17-18H,1-12H2,(H,19,23)(H,21,22) |
| InChIKey | MPAXHVWENUKPNT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|