C9H12N2O — CID 67801776
3-pyrrolidin-1-yl-1H-pyridin-2-one (PubChem CID 67801776) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-1H-pyridin-2-one.
| Compound Name | 3-pyrrolidin-1-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67801776 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-pyrrolidin-1-yl-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1N1CCCC1 |
| InChI | InChI=1S/C9H12N2O/c12-9-8(4-3-5-10-9)11-6-1-2-7-11/h3-5H,1-2,6-7H2,(H,10,12) |
| InChIKey | UBCHBKFVYILRBE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |