C14H22FN3O — CID 137449082
1-[(3R)-1-(2-fluoroethyl)pyrrolidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one (PubChem CID 137449082) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-[(3R)-1-(2-fluoroethyl)pyrrolidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one.
| Compound Name | 1-[(3R)-1-(2-fluoroethyl)pyrrolidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one |
|---|---|
| PubChem CID | 137449082 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-[(3R)-1-(2-fluoroethyl)pyrrolidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one |
| SMILES | CC(C)Nc1cccn([C@@H]2CCN(CCF)C2)c1=O |
| InChI | InChI=1S/C14H22FN3O/c1-11(2)16-13-4-3-7-18(14(13)19)12-5-8-17(10-12)9-6-15/h3-4,7,11-12,16H,5-6,8-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | NPYRASQXCKCZTC-GFCCVEGCSA-N |
| XLogP | 1.88 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |