C9H12FN3O — CID 66693164
1-(4-aminopyrrolidin-3-yl)-5-fluoropyridin-2-one (PubChem CID 66693164) has the molecular formula C9H12FN3O and a molecular weight of 197.21 g/mol. Its IUPAC name is 1-(4-aminopyrrolidin-3-yl)-5-fluoropyridin-2-one.
| Compound Name | 1-(4-aminopyrrolidin-3-yl)-5-fluoropyridin-2-one |
|---|---|
| PubChem CID | 66693164 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-(4-aminopyrrolidin-3-yl)-5-fluoropyridin-2-one |
| SMILES | NC1CNCC1n1cc(F)ccc1=O |
| InChI | InChI=1S/C9H12FN3O/c10-6-1-2-9(14)13(5-6)8-4-12-3-7(8)11/h1-2,5,7-8,12H,3-4,11H2 |
| InChIKey | WEDUQKIXZZQNDI-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |