C8H13FN2O — CID 155030598
N-(4-fluoro-1-methylpyrrolidin-3-yl)prop-2-enamide (PubChem CID 155030598) has the molecular formula C8H13FN2O and a molecular weight of 172.20 g/mol. Its IUPAC name is N-(4-fluoro-1-methylpyrrolidin-3-yl)prop-2-enamide.
| Compound Name | N-(4-fluoro-1-methylpyrrolidin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 155030598 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N-(4-fluoro-1-methylpyrrolidin-3-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CN(C)CC1F |
| InChI | InChI=1S/C8H13FN2O/c1-3-8(12)10-7-5-11(2)4-6(7)9/h3,6-7H,1,4-5H2,2H3,(H,10,12) |
| InChIKey | ASZVVSIVOWFLBL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|