C40H38N2O5 — CID 67803503
2-(2-hydroxyethoxy)ethanol;3-(N-[4-[4-(N-(3-hydroxyphenyl)anilino)phenyl]phenyl]anilino)phenol (PubChem CID 67803503) has the molecular formula C40H38N2O5 and a molecular weight of 626.75 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;3-(N-[4-[4-(N-(3-hydroxyphenyl)anilino)phenyl]phenyl]anilino)phenol.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;3-(N-[4-[4-(N-(3-hydroxyphenyl)anilino)phenyl]phenyl]anilino)phenol |
|---|---|
| PubChem CID | 67803503 |
| Molecular Formula | C40H38N2O5 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;3-(N-[4-[4-(N-(3-hydroxyphenyl)anilino)phenyl]phenyl]anilino)phenol |
| SMILES | OCCOCCO.Oc1cccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(O)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C36H28N2O2.C4H10O3/c39-35-15-7-13-33(25-35)37(29-9-3-1-4-10-29)31-21-17-27(18-22-31)28-19-23-32(24-20-28)38(30-11-5-2-6-12-30)34-14-8-16-36(40)26-34;5-1-3-7-4-2-6/h1-26,39-40H;5-6H,1-4H2 |
| InChIKey | CQJKTAMZPKGGSK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|