C27H29KNO7S — CID 67807485
CID 67807485 (PubChem CID 67807485) has the molecular formula C27H29KNO7S and a molecular weight of 550.69 g/mol.
| Compound Name | CID 67807485 |
|---|---|
| PubChem CID | 67807485 |
| Molecular Formula | C27H29KNO7S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | — |
| SMILES | COc1cc(CC(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)cc(OC)c1.[K] |
| InChI | InChI=1S/C27H29NO7S.K/c1-17(2)19-5-8-23(9-6-19)36(30,31)28-27(29)24(20-7-10-25-26(14-20)35-16-34-25)13-18-11-21(32-3)15-22(12-18)33-4;/h5-12,14-15,17,24H,13,16H2,1-4H3,(H,28,29); |
| InChIKey | WWBUVOAKPHUJKG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |