C27H27F3N2O7S — CID 67723017
3-(4-aminophenyl)-2-(1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 67723017) has the molecular formula C27H27F3N2O7S and a molecular weight of 580.58 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2-(1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-aminophenyl)-2-(1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67723017 |
| Molecular Formula | C27H27F3N2O7S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 3-(4-aminophenyl)-2-(1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)NC(=O)C(Cc2ccc(N)cc2)c2ccc3c(c2)OCO3)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26N2O5S.C2HF3O2/c1-16(2)18-5-10-21(11-6-18)33(29,30)27-25(28)22(13-17-3-8-20(26)9-4-17)19-7-12-23-24(14-19)32-15-31-23;3-2(4,5)1(6)7/h3-12,14,16,22H,13,15,26H2,1-2H3,(H,27,28);(H,6,7) |
| InChIKey | FXCOMCLMSWJMEJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|