C26H21N3O2S — CID 67808033
4-(1-benzothiophen-3-yl)-N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzamide (PubChem CID 67808033) has the molecular formula C26H21N3O2S and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzamide.
| Compound Name | 4-(1-benzothiophen-3-yl)-N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 67808033 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(-c3csc4ccccc34)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H21N3O2S/c1-17-14-29(16-27-17)23-12-11-20(13-24(23)31-2)28-26(30)19-9-7-18(8-10-19)22-15-32-25-6-4-3-5-21(22)25/h3-16H,1-2H3,(H,28,30) |
| InChIKey | JNKKCOWTWXJOIQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |