C21H24N4O2 — CID 24855735
1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(3-phenylpropyl)urea (PubChem CID 24855735) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 24855735 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(3-phenylpropyl)urea |
| SMILES | COc1cc(NC(=O)NCCCc2ccccc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-16-14-25(15-23-16)19-11-10-18(13-20(19)27-2)24-21(26)22-12-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-11,13-15H,6,9,12H2,1-2H3,(H2,22,24,26) |
| InChIKey | NQVHBXPMKDIQBX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|