C23H24ClN5O — CID 173286043
3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3-phenylprop-1-en-2-ylamino)prop-2-enimidoyl chloride (PubChem CID 173286043) has the molecular formula C23H24ClN5O and a molecular weight of 421.93 g/mol. Its IUPAC name is 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3-phenylprop-1-en-2-ylamino)prop-2-enimidoyl chloride.
| Compound Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3-phenylprop-1-en-2-ylamino)prop-2-enimidoyl chloride |
|---|---|
| PubChem CID | 173286043 |
| Molecular Formula | C23H24ClN5O |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3-phenylprop-1-en-2-ylamino)prop-2-enimidoyl chloride |
| SMILES | [H]/N=C(\Cl)C=C(NC(=C)Cc1ccccc1)Nc1ccc(-n2cnc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C23H24ClN5O/c1-16(11-18-7-5-4-6-8-18)27-23(13-22(24)25)28-19-9-10-20(21(12-19)30-3)29-14-17(2)26-15-29/h4-10,12-15,25,27-28H,1,11H2,2-3H3/b23-13?,25-22- |
| InChIKey | SOJXUVALWPZTRL-DZHPILQMSA-N |
| XLogP | 5.00 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|