C17H20ClN5O — CID 173286628
(Z)-3-amino-N-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenyl]but-2-enimidoyl chloride (PubChem CID 173286628) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is (Z)-3-amino-N-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenyl]but-2-enimidoyl chloride.
| Compound Name | (Z)-3-amino-N-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenyl]but-2-enimidoyl chloride |
|---|---|
| PubChem CID | 173286628 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (Z)-3-amino-N-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenyl]but-2-enimidoyl chloride |
| SMILES | C=C(N=C(Cl)/C=C(/C)N)Nc1ccc(-n2cnc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C17H20ClN5O/c1-11(19)7-17(18)22-13(3)21-14-5-6-15(16(8-14)24-4)23-9-12(2)20-10-23/h5-10,21H,3,19H2,1-2,4H3/b11-7-,22-17? |
| InChIKey | BOGXAHMOKRPXHX-FPCAZAIMSA-N |
| XLogP | 3.57 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|