C25H24F3N5O2 — CID 173286641
(Z)-5-amino-3-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenylimino]-5-[4-(trifluoromethyl)phenyl]pent-4-en-2-one (PubChem CID 173286641) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is (Z)-5-amino-3-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenylimino]-5-[4-(trifluoromethyl)phenyl]pent-4-en-2-one.
| Compound Name | (Z)-5-amino-3-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenylimino]-5-[4-(trifluoromethyl)phenyl]pent-4-en-2-one |
|---|---|
| PubChem CID | 173286641 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (Z)-5-amino-3-[1-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]ethenylimino]-5-[4-(trifluoromethyl)phenyl]pent-4-en-2-one |
| SMILES | C=C(N=C(/C=C(\N)c1ccc(C(F)(F)F)cc1)C(C)=O)Nc1ccc(-n2cnc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C25H24F3N5O2/c1-15-13-33(14-30-15)23-10-9-20(11-24(23)35-4)31-17(3)32-22(16(2)34)12-21(29)18-5-7-19(8-6-18)25(26,27)28/h5-14,31H,3,29H2,1-2,4H3/b21-12-,32-22? |
| InChIKey | QFBHNBODXYVZAK-OSMAELOXSA-N |
| XLogP | 5.12 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|