C28H28N2O4 — CID 67813423
3-[1-[[2-[bis(4-hydroxyphenyl)methyl]phenyl]methyl]piperidin-4-yl]-1,3-oxazol-2-one (PubChem CID 67813423) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[1-[[2-[bis(4-hydroxyphenyl)methyl]phenyl]methyl]piperidin-4-yl]-1,3-oxazol-2-one.
| Compound Name | 3-[1-[[2-[bis(4-hydroxyphenyl)methyl]phenyl]methyl]piperidin-4-yl]-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 67813423 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-[1-[[2-[bis(4-hydroxyphenyl)methyl]phenyl]methyl]piperidin-4-yl]-1,3-oxazol-2-one |
| SMILES | O=c1occn1C1CCN(Cc2ccccc2C(c2ccc(O)cc2)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C28H28N2O4/c31-24-9-5-20(6-10-24)27(21-7-11-25(32)12-8-21)26-4-2-1-3-22(26)19-29-15-13-23(14-16-29)30-17-18-34-28(30)33/h1-12,17-18,23,27,31-32H,13-16,19H2 |
| InChIKey | WKOJWYWJIZUKIY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|