C17H23NO2 — CID 117436283
3-cyclopropyl-3-[2-(pyrrolidin-1-ylmethyl)phenyl]propanoic acid (PubChem CID 117436283) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-cyclopropyl-3-[2-(pyrrolidin-1-ylmethyl)phenyl]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[2-(pyrrolidin-1-ylmethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117436283 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-cyclopropyl-3-[2-(pyrrolidin-1-ylmethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CC(c1ccccc1CN1CCCC1)C1CC1 |
| InChI | InChI=1S/C17H23NO2/c19-17(20)11-16(13-7-8-13)15-6-2-1-5-14(15)12-18-9-3-4-10-18/h1-2,5-6,13,16H,3-4,7-12H2,(H,19,20) |
| InChIKey | YOUBDOFADNPQJJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |