3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid

C19H17NO3 — CID 117492322

IUPAC3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid
SMILESO=C(O)CC(c1ccccc1-c1nc2ccccc2o1)C1CC1
InChIInChI=1S/C19H17NO3/c21-18(22)11-15(12-9-10-12)13-5-1-2-6-14(13)19-20-16-7-3-4-8-17(16)23-19/h1-8,12,15H,9-11H2,(H,21,22)
InChIKeyZXFMDRLSLGQDIH-UHFFFAOYSA-N
MW307.35 g/mol
LogP4.46
Rot. Bonds5

About 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid

3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid (PubChem CID 117492322) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid.

Molecular Properties

Compound Name3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid
PubChem CID117492322
Molecular FormulaC19H17NO3
Molecular Weight307.35 g/mol
Exact Mass307.12
IUPAC Name3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid
SMILESO=C(O)CC(c1ccccc1-c1nc2ccccc2o1)C1CC1
InChIInChI=1S/C19H17NO3/c21-18(22)11-15(12-9-10-12)13-5-1-2-6-14(13)19-20-16-7-3-4-8-17(16)23-19/h1-8,12,15H,9-11H2,(H,21,22)
InChIKeyZXFMDRLSLGQDIH-UHFFFAOYSA-N
XLogP4.46
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 54.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid?
The IUPAC name of 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid (CID 117492322) is 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid.
What is the SMILES notation for 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid?
The canonical SMILES for 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid is O=C(O)CC(c1ccccc1-c1nc2ccccc2o1)C1CC1.
What is the InChIKey of 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid?
The InChIKey is ZXFMDRLSLGQDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3/c21-18(22)11-15(12-9-10-12)13-5-1-2-6-14(13)19-20-16-7-3-4-8-17(16)23-19/h1-8,12,15H,9-11H2,(H,21,22).
What are the key properties of 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid?
3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid has a molecular weight of 307.35 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-benzoxazol-2-yl)phenyl]-3-cyclopropylpropanoic acid is sourced from PubChem (CID 117492322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).